Urolitín B (1139-83-9 factory Výrobná továreň

Urolitín B

Novembra 9, 2020

Urolitín BSPECIFIKACE

Názov: Urolitín B
Chemický názov: 3-hydroxy-6H-dibenzo [b, d] pyrán-6-onu
CAS: 1139 83 - 9
Chemický vzorec: C13H8O3
Molekulová hmotnosť: X
Farba:  Biely prášok
Kľúč InChi: WXUQMTRHPNOXBV-UHFFFAOYSA-N
SMILES kód: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Funkcia: Urolitín B môže zlepšovať mitochondriálnu a svalovú funkciu.

Urolitín B môže zlepšiť pevnosť svalov a vytrvalosť počas starnutia.

použitie: Urolitín B je črevný mikrobiálny metabolit ellagitannis a vykazuje silné antioxidačné a prooxidačné aktivity v závislosti od systému a podmienok testu. Urolitín B môže tiež vykazovať estrogénnu a / alebo antiestrogénnu aktivitu.
rozpustnosť: Ľahko rozpustný v N, N-dimetylformamide a dimetylmetyléne. Sulfón, mierne rozpustný v metanole, etanole a etylacetáte
Teplota skladovania: Hygroskopický, -20 ° C mraznička, Pod inertnou atmosférou
Dodacie podmienky: Dodáva sa pri teplote okolia ako chemická látka, ktorá nie je nebezpečná. Tento výrobok je dostatočne stabilný počas niekoľkých týždňov počas bežnej námornej dopravy a času stráveného v colnom režime.