Urolitín B prášok

Novembra 9, 2020

Cofttek je najlepší výrobca prášku Urolithin B v Číne. Naša továreň má kompletný systém riadenia výroby (ISO9001 a ISO14001) s mesačnou výrobnou kapacitou 200 kg.

 


status: V masovej výrobe
Merná jednotka: 1 kg / vrece, 25 kg / bubon

Urolitín BSPECIFIKACE

Názov: Urolitín B
Chemický názov: 3-hydroxy-6H-dibenzo [b, d] pyrán-6-onu
CAS: 1139 83 - 9
Chemický vzorec: C13H8O3
Molekulová hmotnosť: X
Farba:  Biely prášok
Kľúč InChi: WXUQMTRHPNOXBV-UHFFFAOYSA-N
SMILES kód: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Funkcia: Urolitín B môže zlepšovať mitochondriálnu a svalovú funkciu.

Urolitín B môže zlepšiť pevnosť svalov a vytrvalosť počas starnutia.

použitie: Urolitín B je črevný mikrobiálny metabolit ellagitannis a vykazuje silné antioxidačné a prooxidačné aktivity v závislosti od systému a podmienok testu. Urolitín B môže tiež vykazovať estrogénnu a / alebo antiestrogénnu aktivitu.
rozpustnosť: Ľahko rozpustný v N, N-dimetylformamide a dimetylmetyléne. Sulfón, mierne rozpustný v metanole, etanole a etylacetáte
Teplota skladovania: Hygroskopický, -20 ° C mraznička, Pod inertnou atmosférou
Dodacie podmienky: Dodáva sa pri teplote okolia ako chemická látka, ktorá nie je nebezpečná. Tento výrobok je dostatočne stabilný počas niekoľkých týždňov počas bežnej námornej dopravy a času stráveného v colnom režime.

 

Urolitín B NMR spektrum

Urolitín B (1139-83-9) - NMR spektrum

 

Ak potrebujete Certifikát pravosti, MSDS, HNMR pre každú dávku produktu a ďalšie informácie, kontaktujte nás marketingový manažér.

 

Úvod do urolitínov

Urolitíny sú sekundárne metabolity kyseliny ellagovej odvodené od ellagitanínov. U ľudí sa ellagitaníny konvertujú črevnou mikroflórou na kyselinu ellagovú, ktorá sa ďalej transformuje na urolitíny A, urolitín B, urolitín C a urolitín D v hrubom čreve.

Urolitín A (UA) je najbežnejším metabolitom ellagitanínov. Nie je však známe, že by sa urolitín A prirodzene vyskytoval v akýchkoľvek potravinových zdrojoch.

Urolitín B (UB) je hojný metabolit produkovaný v čreve transformáciou ellagitanínov. Urolitín B je posledným produktom po katabolizácii všetkých ostatných derivátov urolitínu. Urolitín B sa nachádza v moči ako urolitín B glukuronid.

Urolitín 8-metyl-éter je medziproduktom pri syntéze urolitínu A. Je to významný sekundárny metabolit ellagitanínu a má antioxidačné a protizápalové vlastnosti.

 

Mechanizmus účinku urolitínu A a B.

● Urolitín A indukuje mitofágiu

Mitofágia je jednou z foriem autofágy, ktorá pomáha eliminovať poškodené mitochondriálne bunky pre ich optimálne fungovanie. Autofágia znamená všeobecný proces, pri ktorom sa cytoplazmatický obsah degraduje a následne recykluje, zatiaľ čo mitofágia je degradácia a recyklácia mitochondrie.

Počas starnutia je pokles autofágie jedným z aspektov vedúcich k poklesu mitochondriálnych funkcií. Ďalej môže oxidačný stres tiež viesť k nízkej autofágii. Urolitín A je schopný eliminovať poškodené mitochondrie selektívnou autofágiou.

● Antioxidačné vlastnosti

K oxidačnému stresu dochádza, keď je v tele nerovnováha medzi voľnými radikálmi a antioxidantom. Tieto nadbytočné voľné radikály sú často spojené s mnohými chronickými chorobami, ako sú srdcové poruchy, cukrovka a rakovina.

Urolitíny A a B vykazujú antioxidačné účinky vďaka svojej schopnosti redukovať voľné radikály a konkrétne hladiny intracelulárnych reaktívnych druhov kyslíka (ROS) a tiež inhibovať peroxidáciu lipidov v určitých bunkových typoch.

Ďalej sú urolitíny schopné inhibovať niektoré oxidačné enzýmy, vrátane monoaminooxidázy A a tyrozinázy.

● Protizápalové vlastnosti

Zápal je prirodzený proces, pri ktorom naše telá bojujú proti všetkým padlým, ako sú infekcie, zranenia a mikróby. Chronický zápal však môže byť pre telo škodlivý, pretože je spojený s rôznymi poruchami, ako je astma, srdcové problémy a rakovina. Chronický zápal môže nastať v dôsledku neliečeného akútneho zápalu, infekcií alebo dokonca voľných radikálov v tele.

Urolitíny A a B vykazujú protizápalové vlastnosti inhibíciou produkcie oxidu dusnatého. Špecificky inhibujú expresiu indukovateľného proteínu syntázy oxidu dusnatého (iNOS) a expresiu mRNA, ktoré sú zodpovedné za zápal.

● Antimikrobiálne účinky

Mikróby vrátane baktérií, húb a vírusov sa prirodzene vyskytujú v prostredí a dokonca aj v ľudskom tele. Niekoľko mikróbov označovaných ako patogény by však mohlo spôsobiť infekčné choroby, ako sú chrípka, osýpky a malária.

Urolitín A a B sú schopné vykazovať antimikrobiálnu aktivitu inhibíciou snímania kvora. Snímanie kvora je režim bakteriálnej komunikácie, ktorý umožňuje baktériám detekovať a riadiť procesy súvisiace s infekciami, ako sú virulencia a motilita.

● Inhibícia glykácie proteínov

Glykácia znamená neenzymatické pripojenie cukru k lipidu alebo proteínu. Je kľúčovým biomarkerom pri cukrovke a ďalších poruchách, ako aj starnutí.

Vysoká proteínová glykácia je sekundárny účinok hyperglykémie, ktorá má hlavnú úlohu pri kardiovaskulárnych poruchách, ako je cukrovka a Alzheimerova choroba.

Urolitín A a B majú anti-glykatívne vlastnosti, ktoré závisia od dávky a sú nezávislé od ich antioxidačnej aktivity.

 

Výhody urolitínu B

Urolitín B doplnky majú tiež niekoľko zdravotných výhod a väčšina z nich je podobná výhodám urolitínu A.

(1) Protirakovinový potenciál
Protizápalové vlastnosti urolitínu B ho robia dobrým kandidátom na boj proti rakovine. Niektorí vedci uviedli tento potenciál vo fibroblastoch, mikrofágoch a endotelových bunkách.

Štúdie uvádzajú, že UB inhibuje rôzne typy rakoviny, ako je rakovina prostaty, hrubého čreva a močového mechúra.

V štúdii zahŕňajúcej ľudské bunky rakoviny hrubého čreva sa hodnotil ellagitaníny, kyselina ellagová a urolitíny A a B na ich protirakovinový potenciál. Uviedli, že všetky liečby boli schopné inhibovať rast rakovinových buniek. Inhibovali proliferáciu rakovinových buniek prostredníctvom zastavenia bunkového cyklu v rôznych fázach a tiež indukciou apoptózy.

(2) Môže pomôcť v boji proti oxidačnému stresu
Urolitín B má vynikajúce antioxidačné vlastnosti znížením hladiny reaktívnych foriem kyslíka a peroxidáciou lipidov v určitých bunkových typoch. Vysoké hladiny ROS sú spojené s mnohými poruchami, ako je Alzheimerova choroba.

V štúdii s neuronálnymi bunkami vystavenými oxidačnému stresu sa zistilo, že doplnok urolitínu B, ako aj urolitín A chránia bunky pred oxidáciou, a teda zvyšujú prežitie buniek.

(3) Urolitín B na vylepšenie pamäte
Uvádza sa, že urolitín b zlepšuje priepustnosť pre krvnú bariéru. To zlepšuje kognitívne fungovanie.

Štúdie ukazujú, že urolitín B môže byť potenciálnym zosilňovačom pamäte zlepšením všeobecnej kognitívnej funkcie.

(4) Zabraňuje strate svalovej hmoty
K strate svalov môže dôjsť z rôznych dôvodov, ako sú poruchy, starnutie a nedostatok bielkovín v potrave. Možno použiť niekoľko opatrení na zastavenie, obmedzenie alebo lepšie predchádzanie úbytku svalov vrátane cvičenia, liekov a aminokyselín, ako aj polyfenolov.

Urolitíny môžu byť klasifikované ako polyfenoly a zohrávajú úlohu pri prevencii úbytku svalov aktiváciou syntézy svalových proteínov a tiež spomaľovaním degradácie.

V štúdii s myšami sa zistilo, že doplnky urolitínu B podávané po určitú dobu zvyšujú ich vývoj svalov, keď sa ukázalo, že svaly sa zväčšujú.

(5) Urolitín B bojuje proti zápalu
Urolitín B má protizápalové vlastnosti znížením väčšiny zápalových markerov.

V štúdii na potkanoch s indukovanou renálnou fibrózou sa zistilo, že urolitín B zmierňuje poškodenie obličiek. Zlepšil funkciu obličiek, morfológiu obličiek a znížil markery poškodenia obličiek. To naznačuje, že UB bol schopný zmierniť zápal obličiek.

(6) Synergické výhody urolitínu A a B.
Synergické účinky boli tiež hlásené pri kombinácii urolitínu A a B na kognitívne funkcie a kapacitu. Štúdia uviedla, že túto kombináciu je možné použiť na liečbu alebo prevenciu porúch spojených s demenciou, ako je úzkosť alebo Alzheimerova choroba.

Ďalšie výhody spojené s urolitínmi sú;

  • neuroprotekce
  • Zmierňuje metabolický syndróm

 

Potravinové zdroje urolitínu A a B

Nie je známe, že urolitíny sa vyskytujú prirodzene v akýchkoľvek potravinách. Sú produktom transformácie ellagových kyselín, ktoré sú odvodené od ellagitanínov. Pomocou črevnej mikrobioty sa ellagitaníny transformujú na kyseliny elagové a kyselina ellagová sa ďalej v hrubom čreve premieňa na svoje metabolity (urolitíny).

Ellagitaníny sa prirodzene vyskytujú v potravinových zdrojoch, ako sú granátové jablká, bobule vrátane jahôd, malín, morušiek a ostružín, hrozno muscadine, mandle, guajavy, čaj a orechy, ako sú vlašské orechy a gaštany, ako aj nápoje z dubového dreva, napríklad červené víno a whisky z dubové sudy.

Môžeme teda dospieť k záveru, že potraviny urolitínu A a potraviny urolitínu B sú potravinami bohatými na ellagitanín. Stojí za zmienku, že biologická dostupnosť ellagitanínu je veľmi obmedzená, zatiaľ čo jeho sekundárne metabolity (urolitíny) sú ľahko biologicky dostupné.

Vylučovanie a produkcia urolitínov sa u jednotlivcov veľmi líšia, pretože konverzia z ellagitanínov závisí od mikrobioty v čreve. Na tejto premene sú zapojené špecifické baktérie, ktoré sa líšia u jednotlivcov, kde niektorí majú vysokú, nízku alebo žiadnu vhodnú mikrobiotu. Potravinové zdroje sa tiež líšia v hladinách ellagitanínov. Potenciálne výhody ellagitanínov sa preto u jednotlivých jedincov líšia.

 

Urolitín A a B doplnky

Urolitín A ako aj doplnky urolitínu B sa na trhu ľahko nachádzajú ako doplnky výživy bohaté na ellagitanín. Ľahko dostupné sú aj doplnky urolitínu A. Hlavne doplnky z granátových jabĺk sa hojne predávajú a používajú sa s úspechom. Tieto doplnky sú syntetizované z ovocia alebo orechov a formulované do tekutej alebo práškovej formy.

Kvôli zmenám v koncentrácii ellagitanínov v rôznych potravinách si zákazníci urolitínu kupujú tento produkt s ohľadom na zdroj potravy. To isté platí pri získavaní práškov alebo tekutých doplnkov urolitínu B.

Niekoľko klinických štúdií u ľudí uskutočnených s práškom urolitínu A alebo B neuviedlo žiadne závažné vedľajšie účinky pri podávaní týchto doplnkov.

Fotogaléria

  1. Garcia-Muñoz, Cristina; Vaillant, Fabrice (2014-12-02). „Metabolický osud ellagitanínov: dôsledky pre zdravie a perspektívy výskumu pre inovatívne funkčné potraviny“. Kritické recenzie v oblasti potravinovej vedy a výživy.
  2. Bialonska D, Kasimsetty SG, Khan SI, Ferreira D (11. novembra 2009). "Urolitíny, črevné mikrobiálne metabolity ellagitanínov z granátového jablka, vykazujú v bunkovom teste silnú antioxidačnú aktivitu." J Agric Food Chem.
  3. Bodwell, Graham; Pottie, Ian; Nandaluru, Penchal (2011). „Celková syntéza Urolithinu M7 na báze inverznej elektriny a dopytu po Diels-Alderovi“.